C22H34FIN6O2 — CID 110021149
3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-1-[(3-fluoro-4-methoxyphenyl)methyl]-1-methyl-2-(oxan-2-ylmethyl)guanidine;hydroiodide (PubChem CID 110021149) has the molecular formula C22H34FIN6O2 and a molecular weight of 560.46 g/mol. Its IUPAC name is 3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-1-[(3-fluoro-4-methoxyphenyl)methyl]-1-methyl-2-(oxan-2-ylmethyl)guanidine;hydroiodide.
| Compound Name | 3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-1-[(3-fluoro-4-methoxyphenyl)methyl]-1-methyl-2-(oxan-2-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 110021149 |
| Molecular Formula | C22H34FIN6O2 |
| Molecular Weight | 560.46 g/mol |
| Exact Mass | 560.18 |
| IUPAC Name | 3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-1-[(3-fluoro-4-methoxyphenyl)methyl]-1-methyl-2-(oxan-2-ylmethyl)guanidine;hydroiodide |
| SMILES | CCc1nncn1CCN/C(=N\CC1CCCCO1)N(C)Cc1ccc(OC)c(F)c1.I |
| InChI | InChI=1S/C22H33FN6O2.HI/c1-4-21-27-26-16-29(21)11-10-24-22(25-14-18-7-5-6-12-31-18)28(2)15-17-8-9-20(30-3)19(23)13-17;/h8-9,13,16,18H,4-7,10-12,14-15H2,1-3H3,(H,24,25);1H |
| InChIKey | UKVRXBLLQYFWCS-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 76.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.46 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|