C19H28FIN6 — CID 111514289
3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-1-[(3-fluorophenyl)methyl]-1-methyl-2-(2-methylprop-2-enyl)guanidine;hydroiodide (PubChem CID 111514289) has the molecular formula C19H28FIN6 and a molecular weight of 486.38 g/mol. Its IUPAC name is 3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-1-[(3-fluorophenyl)methyl]-1-methyl-2-(2-methylprop-2-enyl)guanidine;hydroiodide.
| Compound Name | 3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-1-[(3-fluorophenyl)methyl]-1-methyl-2-(2-methylprop-2-enyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111514289 |
| Molecular Formula | C19H28FIN6 |
| Molecular Weight | 486.38 g/mol |
| Exact Mass | 486.14 |
| IUPAC Name | 3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-1-[(3-fluorophenyl)methyl]-1-methyl-2-(2-methylprop-2-enyl)guanidine;hydroiodide |
| SMILES | C=C(C)C/N=C(\NCCn1cnnc1CC)N(C)Cc1cccc(F)c1.I |
| InChI | InChI=1S/C19H27FN6.HI/c1-5-18-24-23-14-26(18)10-9-21-19(22-12-15(2)3)25(4)13-16-7-6-8-17(20)11-16;/h6-8,11,14H,2,5,9-10,12-13H2,1,3-4H3,(H,21,22);1H |
| InChIKey | JRKMLESVLIDOHB-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 58.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.38 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|