C21H32ClIN6O — CID 110020991
1-[1-(2-chlorophenyl)ethyl]-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-(oxan-2-ylmethyl)guanidine;hydroiodide (PubChem CID 110020991) has the molecular formula C21H32ClIN6O and a molecular weight of 546.89 g/mol. Its IUPAC name is 1-[1-(2-chlorophenyl)ethyl]-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-(oxan-2-ylmethyl)guanidine;hydroiodide.
| Compound Name | 1-[1-(2-chlorophenyl)ethyl]-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-(oxan-2-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 110020991 |
| Molecular Formula | C21H32ClIN6O |
| Molecular Weight | 546.89 g/mol |
| Exact Mass | 546.14 |
| IUPAC Name | 1-[1-(2-chlorophenyl)ethyl]-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-(oxan-2-ylmethyl)guanidine;hydroiodide |
| SMILES | CCc1nncn1CCN/C(=N\CC1CCCCO1)NC(C)c1ccccc1Cl.I |
| InChI | InChI=1S/C21H31ClN6O.HI/c1-3-20-27-25-15-28(20)12-11-23-21(24-14-17-8-6-7-13-29-17)26-16(2)18-9-4-5-10-19(18)22;/h4-5,9-10,15-17H,3,6-8,11-14H2,1-2H3,(H2,23,24,26);1H |
| InChIKey | XBOAKZPJSMXCRJ-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 76.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.89 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|