C22H29IN6O2S — CID 111513901
2-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)-1-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-3-(1-thiophen-2-ylethyl)guanidine;hydroiodide (PubChem CID 111513901) has the molecular formula C22H29IN6O2S and a molecular weight of 568.49 g/mol. Its IUPAC name is 2-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)-1-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-3-(1-thiophen-2-ylethyl)guanidine;hydroiodide.
| Compound Name | 2-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)-1-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-3-(1-thiophen-2-ylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111513901 |
| Molecular Formula | C22H29IN6O2S |
| Molecular Weight | 568.49 g/mol |
| Exact Mass | 568.11 |
| IUPAC Name | 2-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)-1-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-3-(1-thiophen-2-ylethyl)guanidine;hydroiodide |
| SMILES | CCc1nncn1CCN/C(=N\CC1COc2ccccc2O1)NC(C)c1cccs1.I |
| InChI | InChI=1S/C22H28N6O2S.HI/c1-3-21-27-25-15-28(21)11-10-23-22(26-16(2)20-9-6-12-31-20)24-13-17-14-29-18-7-4-5-8-19(18)30-17;/h4-9,12,15-17H,3,10-11,13-14H2,1-2H3,(H2,23,24,26);1H |
| InChIKey | JHAWOMJYZOQVRI-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 85.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.49 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|