C18H30N6S — CID 111494842
1-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-(3-methylbutyl)-3-(2-thiophen-2-ylethyl)guanidine (PubChem CID 111494842) has the molecular formula C18H30N6S and a molecular weight of 362.55 g/mol. Its IUPAC name is 1-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-(3-methylbutyl)-3-(2-thiophen-2-ylethyl)guanidine.
| Compound Name | 1-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-(3-methylbutyl)-3-(2-thiophen-2-ylethyl)guanidine |
|---|---|
| PubChem CID | 111494842 |
| Molecular Formula | C18H30N6S |
| Molecular Weight | 362.55 g/mol |
| Exact Mass | 362.23 |
| IUPAC Name | 1-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-(3-methylbutyl)-3-(2-thiophen-2-ylethyl)guanidine |
| SMILES | CCc1nncn1CCN/C(=N/CCC(C)C)NCCc1cccs1 |
| InChI | InChI=1S/C18H30N6S/c1-4-17-23-22-14-24(17)12-11-21-18(19-9-7-15(2)3)20-10-8-16-6-5-13-25-16/h5-6,13-15H,4,7-12H2,1-3H3,(H2,19,20,21) |
| InChIKey | RDKWOJZWEGKOBF-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 67.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.55 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|