C22H34N6 — CID 111494844
1-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-(3-methylbutyl)-3-(1,2,3,4-tetrahydronaphthalen-2-yl)guanidine (PubChem CID 111494844) has the molecular formula C22H34N6 and a molecular weight of 382.56 g/mol. Its IUPAC name is 1-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-(3-methylbutyl)-3-(1,2,3,4-tetrahydronaphthalen-2-yl)guanidine.
| Compound Name | 1-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-(3-methylbutyl)-3-(1,2,3,4-tetrahydronaphthalen-2-yl)guanidine |
|---|---|
| PubChem CID | 111494844 |
| Molecular Formula | C22H34N6 |
| Molecular Weight | 382.56 g/mol |
| Exact Mass | 382.28 |
| IUPAC Name | 1-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-(3-methylbutyl)-3-(1,2,3,4-tetrahydronaphthalen-2-yl)guanidine |
| SMILES | CCc1nncn1CCN/C(=N\CCC(C)C)NC1CCc2ccccc2C1 |
| InChI | InChI=1S/C22H34N6/c1-4-21-27-25-16-28(21)14-13-24-22(23-12-11-17(2)3)26-20-10-9-18-7-5-6-8-19(18)15-20/h5-8,16-17,20H,4,9-15H2,1-3H3,(H2,23,24,26) |
| InChIKey | DUMIBMFHISWRGY-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 67.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.56 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|