C22H31IN6OS — CID 111518916
1-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-3-[2-(2-methoxy-5-methylphenyl)ethyl]-2-(thiophen-2-ylmethyl)guanidine;hydroiodide (PubChem CID 111518916) has the molecular formula C22H31IN6OS and a molecular weight of 554.50 g/mol. Its IUPAC name is 1-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-3-[2-(2-methoxy-5-methylphenyl)ethyl]-2-(thiophen-2-ylmethyl)guanidine;hydroiodide.
| Compound Name | 1-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-3-[2-(2-methoxy-5-methylphenyl)ethyl]-2-(thiophen-2-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111518916 |
| Molecular Formula | C22H31IN6OS |
| Molecular Weight | 554.50 g/mol |
| Exact Mass | 554.13 |
| IUPAC Name | 1-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-3-[2-(2-methoxy-5-methylphenyl)ethyl]-2-(thiophen-2-ylmethyl)guanidine;hydroiodide |
| SMILES | CCc1nncn1CCN/C(=N\Cc1cccs1)NCCc1cc(C)ccc1OC.I |
| InChI | InChI=1S/C22H30N6OS.HI/c1-4-21-27-26-16-28(21)12-11-24-22(25-15-19-6-5-13-30-19)23-10-9-18-14-17(2)7-8-20(18)29-3;/h5-8,13-14,16H,4,9-12,15H2,1-3H3,(H2,23,24,25);1H |
| InChIKey | DORACSSVMZUUFD-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 76.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.50 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|