C20H31IN6O — CID 111495265
N'-(3-ethoxypropyl)-N-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2,3-dihydroindole-1-carboximidamide;hydroiodide (PubChem CID 111495265) has the molecular formula C20H31IN6O and a molecular weight of 498.41 g/mol. Its IUPAC name is N'-(3-ethoxypropyl)-N-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2,3-dihydroindole-1-carboximidamide;hydroiodide.
| Compound Name | N'-(3-ethoxypropyl)-N-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2,3-dihydroindole-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111495265 |
| Molecular Formula | C20H31IN6O |
| Molecular Weight | 498.41 g/mol |
| Exact Mass | 498.16 |
| IUPAC Name | N'-(3-ethoxypropyl)-N-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2,3-dihydroindole-1-carboximidamide;hydroiodide |
| SMILES | CCOCCC/N=C(\NCCn1cnnc1CC)N1CCc2ccccc21.I |
| InChI | InChI=1S/C20H30N6O.HI/c1-3-19-24-23-16-25(19)14-12-22-20(21-11-7-15-27-4-2)26-13-10-17-8-5-6-9-18(17)26;/h5-6,8-9,16H,3-4,7,10-15H2,1-2H3,(H,21,22);1H |
| InChIKey | SFNBKZNJJXUHEI-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 67.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.41 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|