C23H29IN6O — CID 111495407
N-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-N'-[(4-methoxyphenyl)methyl]-2,3-dihydroindole-1-carboximidamide;hydroiodide (PubChem CID 111495407) has the molecular formula C23H29IN6O and a molecular weight of 532.43 g/mol. Its IUPAC name is N-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-N'-[(4-methoxyphenyl)methyl]-2,3-dihydroindole-1-carboximidamide;hydroiodide.
| Compound Name | N-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-N'-[(4-methoxyphenyl)methyl]-2,3-dihydroindole-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111495407 |
| Molecular Formula | C23H29IN6O |
| Molecular Weight | 532.43 g/mol |
| Exact Mass | 532.14 |
| IUPAC Name | N-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-N'-[(4-methoxyphenyl)methyl]-2,3-dihydroindole-1-carboximidamide;hydroiodide |
| SMILES | CCc1nncn1CCN/C(=N\Cc1ccc(OC)cc1)N1CCc2ccccc21.I |
| InChI | InChI=1S/C23H28N6O.HI/c1-3-22-27-26-17-28(22)15-13-24-23(25-16-18-8-10-20(30-2)11-9-18)29-14-12-19-6-4-5-7-21(19)29;/h4-11,17H,3,12-16H2,1-2H3,(H,24,25);1H |
| InChIKey | IRSVYINHJXHZDD-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 67.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.43 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|