C22H35N7O2 — CID 111511797
N'-(3-ethoxypropyl)-N-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-4-(2-hydroxyphenyl)piperazine-1-carboximidamide (PubChem CID 111511797) has the molecular formula C22H35N7O2 and a molecular weight of 429.57 g/mol. Its IUPAC name is N'-(3-ethoxypropyl)-N-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-4-(2-hydroxyphenyl)piperazine-1-carboximidamide.
| Compound Name | N'-(3-ethoxypropyl)-N-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-4-(2-hydroxyphenyl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111511797 |
| Molecular Formula | C22H35N7O2 |
| Molecular Weight | 429.57 g/mol |
| Exact Mass | 429.29 |
| IUPAC Name | N'-(3-ethoxypropyl)-N-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-4-(2-hydroxyphenyl)piperazine-1-carboximidamide |
| SMILES | CCOCCC/N=C(\NCCn1cnnc1CC)N1CCN(c2ccccc2O)CC1 |
| InChI | InChI=1S/C22H35N7O2/c1-3-21-26-25-18-29(21)12-11-24-22(23-10-7-17-31-4-2)28-15-13-27(14-16-28)19-8-5-6-9-20(19)30/h5-6,8-9,18,30H,3-4,7,10-17H2,1-2H3,(H,23,24) |
| InChIKey | DFHATEDOIRRSCE-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 91.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.57 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|