C23H37N7O — CID 111493258
4-benzyl-N'-(3-ethoxypropyl)-N-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]piperazine-1-carboximidamide (PubChem CID 111493258) has the molecular formula C23H37N7O and a molecular weight of 427.60 g/mol. Its IUPAC name is 4-benzyl-N'-(3-ethoxypropyl)-N-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]piperazine-1-carboximidamide.
| Compound Name | 4-benzyl-N'-(3-ethoxypropyl)-N-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111493258 |
| Molecular Formula | C23H37N7O |
| Molecular Weight | 427.60 g/mol |
| Exact Mass | 427.31 |
| IUPAC Name | 4-benzyl-N'-(3-ethoxypropyl)-N-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]piperazine-1-carboximidamide |
| SMILES | CCOCCC/N=C(\NCCn1cnnc1CC)N1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C23H37N7O/c1-3-22-27-26-20-30(22)13-12-25-23(24-11-8-18-31-4-2)29-16-14-28(15-17-29)19-21-9-6-5-7-10-21/h5-7,9-10,20H,3-4,8,11-19H2,1-2H3,(H,24,25) |
| InChIKey | QEDRVKBXROBXPD-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 70.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.60 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|