C20H31IN6O2S — CID 111511113
ethyl 1-[N-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-N'-(thiophen-2-ylmethyl)carbamimidoyl]piperidine-4-carboxylate;hydroiodide (PubChem CID 111511113) has the molecular formula C20H31IN6O2S and a molecular weight of 546.48 g/mol. Its IUPAC name is ethyl 1-[N-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-N'-(thiophen-2-ylmethyl)carbamimidoyl]piperidine-4-carboxylate;hydroiodide.
| Compound Name | ethyl 1-[N-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-N'-(thiophen-2-ylmethyl)carbamimidoyl]piperidine-4-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111511113 |
| Molecular Formula | C20H31IN6O2S |
| Molecular Weight | 546.48 g/mol |
| Exact Mass | 546.13 |
| IUPAC Name | ethyl 1-[N-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-N'-(thiophen-2-ylmethyl)carbamimidoyl]piperidine-4-carboxylate;hydroiodide |
| SMILES | CCOC(=O)C1CCN(/C(=N/Cc2cccs2)NCCn2cnnc2CC)CC1.I |
| InChI | InChI=1S/C20H30N6O2S.HI/c1-3-18-24-23-15-26(18)12-9-21-20(22-14-17-6-5-13-29-17)25-10-7-16(8-11-25)19(27)28-4-2;/h5-6,13,15-16H,3-4,7-12,14H2,1-2H3,(H,21,22);1H |
| InChIKey | ZXQLJGZODWOWDR-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 84.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.48 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|