C22H29IN4O4S — CID 110020719
ethyl 1-[N'-[(4-nitrophenyl)methyl]-N-(2-thiophen-2-ylethyl)carbamimidoyl]piperidine-4-carboxylate;hydroiodide (PubChem CID 110020719) has the molecular formula C22H29IN4O4S and a molecular weight of 572.47 g/mol. Its IUPAC name is ethyl 1-[N'-[(4-nitrophenyl)methyl]-N-(2-thiophen-2-ylethyl)carbamimidoyl]piperidine-4-carboxylate;hydroiodide.
| Compound Name | ethyl 1-[N'-[(4-nitrophenyl)methyl]-N-(2-thiophen-2-ylethyl)carbamimidoyl]piperidine-4-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 110020719 |
| Molecular Formula | C22H29IN4O4S |
| Molecular Weight | 572.47 g/mol |
| Exact Mass | 572.10 |
| IUPAC Name | ethyl 1-[N'-[(4-nitrophenyl)methyl]-N-(2-thiophen-2-ylethyl)carbamimidoyl]piperidine-4-carboxylate;hydroiodide |
| SMILES | CCOC(=O)C1CCN(/C(=N/Cc2ccc([N+](=O)[O-])cc2)NCCc2cccs2)CC1.I |
| InChI | InChI=1S/C22H28N4O4S.HI/c1-2-30-21(27)18-10-13-25(14-11-18)22(23-12-9-20-4-3-15-31-20)24-16-17-5-7-19(8-6-17)26(28)29;/h3-8,15,18H,2,9-14,16H2,1H3,(H,23,24);1H |
| InChIKey | DCIJKJHHOJQHJO-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 97.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.47 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|