C20H25IN4O4S — CID 111254018
methyl 1-[N'-[(4-nitrophenyl)methyl]-N-(thiophen-2-ylmethyl)carbamimidoyl]piperidine-4-carboxylate;hydroiodide (PubChem CID 111254018) has the molecular formula C20H25IN4O4S and a molecular weight of 544.42 g/mol. Its IUPAC name is methyl 1-[N'-[(4-nitrophenyl)methyl]-N-(thiophen-2-ylmethyl)carbamimidoyl]piperidine-4-carboxylate;hydroiodide.
| Compound Name | methyl 1-[N'-[(4-nitrophenyl)methyl]-N-(thiophen-2-ylmethyl)carbamimidoyl]piperidine-4-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111254018 |
| Molecular Formula | C20H25IN4O4S |
| Molecular Weight | 544.42 g/mol |
| Exact Mass | 544.06 |
| IUPAC Name | methyl 1-[N'-[(4-nitrophenyl)methyl]-N-(thiophen-2-ylmethyl)carbamimidoyl]piperidine-4-carboxylate;hydroiodide |
| SMILES | COC(=O)C1CCN(/C(=N/Cc2ccc([N+](=O)[O-])cc2)NCc2cccs2)CC1.I |
| InChI | InChI=1S/C20H24N4O4S.HI/c1-28-19(25)16-8-10-23(11-9-16)20(22-14-18-3-2-12-29-18)21-13-15-4-6-17(7-5-15)24(26)27;/h2-7,12,16H,8-11,13-14H2,1H3,(H,21,22);1H |
| InChIKey | NUGSMGQWSDEBBA-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 97.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.42 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|