C19H29IN4O4 — CID 110020866
methyl 1-[N-(2-methylpropyl)-N'-[(4-nitrophenyl)methyl]carbamimidoyl]piperidine-4-carboxylate;hydroiodide (PubChem CID 110020866) has the molecular formula C19H29IN4O4 and a molecular weight of 504.37 g/mol. Its IUPAC name is methyl 1-[N-(2-methylpropyl)-N'-[(4-nitrophenyl)methyl]carbamimidoyl]piperidine-4-carboxylate;hydroiodide.
| Compound Name | methyl 1-[N-(2-methylpropyl)-N'-[(4-nitrophenyl)methyl]carbamimidoyl]piperidine-4-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 110020866 |
| Molecular Formula | C19H29IN4O4 |
| Molecular Weight | 504.37 g/mol |
| Exact Mass | 504.12 |
| IUPAC Name | methyl 1-[N-(2-methylpropyl)-N'-[(4-nitrophenyl)methyl]carbamimidoyl]piperidine-4-carboxylate;hydroiodide |
| SMILES | COC(=O)C1CCN(/C(=N/Cc2ccc([N+](=O)[O-])cc2)NCC(C)C)CC1.I |
| InChI | InChI=1S/C19H28N4O4.HI/c1-14(2)12-20-19(22-10-8-16(9-11-22)18(24)27-3)21-13-15-4-6-17(7-5-15)23(25)26;/h4-7,14,16H,8-13H2,1-3H3,(H,20,21);1H |
| InChIKey | ABGNDFMBWNAYRP-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 97.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.37 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|