C17H26N4O3 — CID 110021025
4-hydroxy-N-(2-methylpropyl)-N'-[(4-nitrophenyl)methyl]piperidine-1-carboximidamide (PubChem CID 110021025) has the molecular formula C17H26N4O3 and a molecular weight of 334.42 g/mol. Its IUPAC name is 4-hydroxy-N-(2-methylpropyl)-N'-[(4-nitrophenyl)methyl]piperidine-1-carboximidamide.
| Compound Name | 4-hydroxy-N-(2-methylpropyl)-N'-[(4-nitrophenyl)methyl]piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 110021025 |
| Molecular Formula | C17H26N4O3 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.20 |
| IUPAC Name | 4-hydroxy-N-(2-methylpropyl)-N'-[(4-nitrophenyl)methyl]piperidine-1-carboximidamide |
| SMILES | CC(C)CN/C(=N\Cc1ccc([N+](=O)[O-])cc1)N1CCC(O)CC1 |
| InChI | InChI=1S/C17H26N4O3/c1-13(2)11-18-17(20-9-7-16(22)8-10-20)19-12-14-3-5-15(6-4-14)21(23)24/h3-6,13,16,22H,7-12H2,1-2H3,(H,18,19) |
| InChIKey | ZIKFQMCWZFKPIW-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 91.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|