C18H25IN4O4 — CID 111255146
methyl 1-[N'-[(4-nitrophenyl)methyl]-N-prop-2-enylcarbamimidoyl]piperidine-4-carboxylate;hydroiodide (PubChem CID 111255146) has the molecular formula C18H25IN4O4 and a molecular weight of 488.33 g/mol. Its IUPAC name is methyl 1-[N'-[(4-nitrophenyl)methyl]-N-prop-2-enylcarbamimidoyl]piperidine-4-carboxylate;hydroiodide.
| Compound Name | methyl 1-[N'-[(4-nitrophenyl)methyl]-N-prop-2-enylcarbamimidoyl]piperidine-4-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111255146 |
| Molecular Formula | C18H25IN4O4 |
| Molecular Weight | 488.33 g/mol |
| Exact Mass | 488.09 |
| IUPAC Name | methyl 1-[N'-[(4-nitrophenyl)methyl]-N-prop-2-enylcarbamimidoyl]piperidine-4-carboxylate;hydroiodide |
| SMILES | C=CCN/C(=N\Cc1ccc([N+](=O)[O-])cc1)N1CCC(C(=O)OC)CC1.I |
| InChI | InChI=1S/C18H24N4O4.HI/c1-3-10-19-18(21-11-8-15(9-12-21)17(23)26-2)20-13-14-4-6-16(7-5-14)22(24)25;/h3-7,15H,1,8-13H2,2H3,(H,19,20);1H |
| InChIKey | DDLNIALKDFCYEQ-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 97.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.33 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|