C20H31IN6O3 — CID 111366590
2-[4-[N'-[(4-nitrophenyl)methyl]-N-prop-2-enylcarbamimidoyl]piperazin-1-yl]-N-propan-2-ylacetamide;hydroiodide (PubChem CID 111366590) has the molecular formula C20H31IN6O3 and a molecular weight of 530.41 g/mol. Its IUPAC name is 2-[4-[N'-[(4-nitrophenyl)methyl]-N-prop-2-enylcarbamimidoyl]piperazin-1-yl]-N-propan-2-ylacetamide;hydroiodide.
| Compound Name | 2-[4-[N'-[(4-nitrophenyl)methyl]-N-prop-2-enylcarbamimidoyl]piperazin-1-yl]-N-propan-2-ylacetamide;hydroiodide |
|---|---|
| PubChem CID | 111366590 |
| Molecular Formula | C20H31IN6O3 |
| Molecular Weight | 530.41 g/mol |
| Exact Mass | 530.15 |
| IUPAC Name | 2-[4-[N'-[(4-nitrophenyl)methyl]-N-prop-2-enylcarbamimidoyl]piperazin-1-yl]-N-propan-2-ylacetamide;hydroiodide |
| SMILES | C=CCN/C(=N\Cc1ccc([N+](=O)[O-])cc1)N1CCN(CC(=O)NC(C)C)CC1.I |
| InChI | InChI=1S/C20H30N6O3.HI/c1-4-9-21-20(22-14-17-5-7-18(8-6-17)26(28)29)25-12-10-24(11-13-25)15-19(27)23-16(2)3;/h4-8,16H,1,9-15H2,2-3H3,(H,21,22)(H,23,27);1H |
| InChIKey | YEUURWGTGUOMEG-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 103.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.41 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|