C22H35IN6O3 — CID 110021163
N-butan-2-yl-N'-[(4-nitrophenyl)methyl]-4-(2-oxo-2-pyrrolidin-1-ylethyl)piperazine-1-carboximidamide;hydroiodide (PubChem CID 110021163) has the molecular formula C22H35IN6O3 and a molecular weight of 558.47 g/mol. Its IUPAC name is N-butan-2-yl-N'-[(4-nitrophenyl)methyl]-4-(2-oxo-2-pyrrolidin-1-ylethyl)piperazine-1-carboximidamide;hydroiodide.
| Compound Name | N-butan-2-yl-N'-[(4-nitrophenyl)methyl]-4-(2-oxo-2-pyrrolidin-1-ylethyl)piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 110021163 |
| Molecular Formula | C22H35IN6O3 |
| Molecular Weight | 558.47 g/mol |
| Exact Mass | 558.18 |
| IUPAC Name | N-butan-2-yl-N'-[(4-nitrophenyl)methyl]-4-(2-oxo-2-pyrrolidin-1-ylethyl)piperazine-1-carboximidamide;hydroiodide |
| SMILES | CCC(C)N/C(=N\Cc1ccc([N+](=O)[O-])cc1)N1CCN(CC(=O)N2CCCC2)CC1.I |
| InChI | InChI=1S/C22H34N6O3.HI/c1-3-18(2)24-22(23-16-19-6-8-20(9-7-19)28(30)31)27-14-12-25(13-15-27)17-21(29)26-10-4-5-11-26;/h6-9,18H,3-5,10-17H2,1-2H3,(H,23,24);1H |
| InChIKey | OTQSRLQRTRKURM-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 94.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.47 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|