C21H31IN6O3 — CID 110021264
N-butan-2-yl-4-[(5-methyl-1,2-oxazol-3-yl)methyl]-N'-[(4-nitrophenyl)methyl]piperazine-1-carboximidamide;hydroiodide (PubChem CID 110021264) has the molecular formula C21H31IN6O3 and a molecular weight of 542.42 g/mol. Its IUPAC name is N-butan-2-yl-4-[(5-methyl-1,2-oxazol-3-yl)methyl]-N'-[(4-nitrophenyl)methyl]piperazine-1-carboximidamide;hydroiodide.
| Compound Name | N-butan-2-yl-4-[(5-methyl-1,2-oxazol-3-yl)methyl]-N'-[(4-nitrophenyl)methyl]piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 110021264 |
| Molecular Formula | C21H31IN6O3 |
| Molecular Weight | 542.42 g/mol |
| Exact Mass | 542.15 |
| IUPAC Name | N-butan-2-yl-4-[(5-methyl-1,2-oxazol-3-yl)methyl]-N'-[(4-nitrophenyl)methyl]piperazine-1-carboximidamide;hydroiodide |
| SMILES | CCC(C)N/C(=N\Cc1ccc([N+](=O)[O-])cc1)N1CCN(Cc2cc(C)on2)CC1.I |
| InChI | InChI=1S/C21H30N6O3.HI/c1-4-16(2)23-21(22-14-18-5-7-20(8-6-18)27(28)29)26-11-9-25(10-12-26)15-19-13-17(3)30-24-19;/h5-8,13,16H,4,9-12,14-15H2,1-3H3,(H,22,23);1H |
| InChIKey | FIEJFHIKPISEIY-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 100.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.42 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|