C21H34N6O3 — CID 110021145
2-[4-[N-butan-2-yl-N'-[(4-nitrophenyl)methyl]carbamimidoyl]piperazin-1-yl]-N-propan-2-ylacetamide (PubChem CID 110021145) has the molecular formula C21H34N6O3 and a molecular weight of 418.54 g/mol. Its IUPAC name is 2-[4-[N-butan-2-yl-N'-[(4-nitrophenyl)methyl]carbamimidoyl]piperazin-1-yl]-N-propan-2-ylacetamide.
| Compound Name | 2-[4-[N-butan-2-yl-N'-[(4-nitrophenyl)methyl]carbamimidoyl]piperazin-1-yl]-N-propan-2-ylacetamide |
|---|---|
| PubChem CID | 110021145 |
| Molecular Formula | C21H34N6O3 |
| Molecular Weight | 418.54 g/mol |
| Exact Mass | 418.27 |
| IUPAC Name | 2-[4-[N-butan-2-yl-N'-[(4-nitrophenyl)methyl]carbamimidoyl]piperazin-1-yl]-N-propan-2-ylacetamide |
| SMILES | CCC(C)N/C(=N\Cc1ccc([N+](=O)[O-])cc1)N1CCN(CC(=O)NC(C)C)CC1 |
| InChI | InChI=1S/C21H34N6O3/c1-5-17(4)24-21(22-14-18-6-8-19(9-7-18)27(29)30)26-12-10-25(11-13-26)15-20(28)23-16(2)3/h6-9,16-17H,5,10-15H2,1-4H3,(H,22,24)(H,23,28) |
| InChIKey | WQLZHASOWDKLLS-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 103.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.54 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|