C20H31IN6O4 — CID 111367718
N-ethyl-4-(2-morpholin-4-yl-2-oxoethyl)-N'-[(4-nitrophenyl)methyl]piperazine-1-carboximidamide;hydroiodide (PubChem CID 111367718) has the molecular formula C20H31IN6O4 and a molecular weight of 546.41 g/mol. Its IUPAC name is N-ethyl-4-(2-morpholin-4-yl-2-oxoethyl)-N'-[(4-nitrophenyl)methyl]piperazine-1-carboximidamide;hydroiodide.
| Compound Name | N-ethyl-4-(2-morpholin-4-yl-2-oxoethyl)-N'-[(4-nitrophenyl)methyl]piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111367718 |
| Molecular Formula | C20H31IN6O4 |
| Molecular Weight | 546.41 g/mol |
| Exact Mass | 546.15 |
| IUPAC Name | N-ethyl-4-(2-morpholin-4-yl-2-oxoethyl)-N'-[(4-nitrophenyl)methyl]piperazine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc([N+](=O)[O-])cc1)N1CCN(CC(=O)N2CCOCC2)CC1.I |
| InChI | InChI=1S/C20H30N6O4.HI/c1-2-21-20(22-15-17-3-5-18(6-4-17)26(28)29)25-9-7-23(8-10-25)16-19(27)24-11-13-30-14-12-24;/h3-6H,2,7-16H2,1H3,(H,21,22);1H |
| InChIKey | FVKOYTOIQWKXEK-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 103.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.41 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|