C21H32N6O4 — CID 110963289
4-acetyl-N-(3-morpholin-4-ylpropyl)-N'-[(4-nitrophenyl)methyl]piperazine-1-carboximidamide (PubChem CID 110963289) has the molecular formula C21H32N6O4 and a molecular weight of 432.53 g/mol. Its IUPAC name is 4-acetyl-N-(3-morpholin-4-ylpropyl)-N'-[(4-nitrophenyl)methyl]piperazine-1-carboximidamide.
| Compound Name | 4-acetyl-N-(3-morpholin-4-ylpropyl)-N'-[(4-nitrophenyl)methyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 110963289 |
| Molecular Formula | C21H32N6O4 |
| Molecular Weight | 432.53 g/mol |
| Exact Mass | 432.25 |
| IUPAC Name | 4-acetyl-N-(3-morpholin-4-ylpropyl)-N'-[(4-nitrophenyl)methyl]piperazine-1-carboximidamide |
| SMILES | CC(=O)N1CCN(/C(=N/Cc2ccc([N+](=O)[O-])cc2)NCCCN2CCOCC2)CC1 |
| InChI | InChI=1S/C21H32N6O4/c1-18(28)25-9-11-26(12-10-25)21(22-7-2-8-24-13-15-31-16-14-24)23-17-19-3-5-20(6-4-19)27(29)30/h3-6H,2,7-17H2,1H3,(H,22,23) |
| InChIKey | YGLJOWOOMYHEQQ-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 103.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.53 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|