C22H28FN5O3 — CID 136924101
2-[(4-fluorophenyl)methyl]-1-(3-morpholin-4-ylpropyl)-3-[(4-nitrophenyl)methyl]guanidine (PubChem CID 136924101) has the molecular formula C22H28FN5O3 and a molecular weight of 429.50 g/mol. Its IUPAC name is 2-[(4-fluorophenyl)methyl]-1-(3-morpholin-4-ylpropyl)-3-[(4-nitrophenyl)methyl]guanidine.
| Compound Name | 2-[(4-fluorophenyl)methyl]-1-(3-morpholin-4-ylpropyl)-3-[(4-nitrophenyl)methyl]guanidine |
|---|---|
| PubChem CID | 136924101 |
| Molecular Formula | C22H28FN5O3 |
| Molecular Weight | 429.50 g/mol |
| Exact Mass | 429.22 |
| IUPAC Name | 2-[(4-fluorophenyl)methyl]-1-(3-morpholin-4-ylpropyl)-3-[(4-nitrophenyl)methyl]guanidine |
| SMILES | O=[N+]([O-])c1ccc(CN/C(=N/Cc2ccc(F)cc2)NCCCN2CCOCC2)cc1 |
| InChI | InChI=1S/C22H28FN5O3/c23-20-6-2-18(3-7-20)16-25-22(24-10-1-11-27-12-14-31-15-13-27)26-17-19-4-8-21(9-5-19)28(29)30/h2-9H,1,10-17H2,(H2,24,25,26) |
| InChIKey | GKZLLDLFYXJUTN-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 92.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.50 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|