C19H32IN5O5 — CID 111255370
1-[2-(2-hydroxyethoxy)ethyl]-3-(3-morpholin-4-ylpropyl)-2-[(4-nitrophenyl)methyl]guanidine;hydroiodide (PubChem CID 111255370) has the molecular formula C19H32IN5O5 and a molecular weight of 537.40 g/mol. Its IUPAC name is 1-[2-(2-hydroxyethoxy)ethyl]-3-(3-morpholin-4-ylpropyl)-2-[(4-nitrophenyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(2-hydroxyethoxy)ethyl]-3-(3-morpholin-4-ylpropyl)-2-[(4-nitrophenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111255370 |
| Molecular Formula | C19H32IN5O5 |
| Molecular Weight | 537.40 g/mol |
| Exact Mass | 537.14 |
| IUPAC Name | 1-[2-(2-hydroxyethoxy)ethyl]-3-(3-morpholin-4-ylpropyl)-2-[(4-nitrophenyl)methyl]guanidine;hydroiodide |
| SMILES | I.O=[N+]([O-])c1ccc(C/N=C(/NCCCN2CCOCC2)NCCOCCO)cc1 |
| InChI | InChI=1S/C19H31N5O5.HI/c25-11-15-28-12-7-21-19(20-6-1-8-23-9-13-29-14-10-23)22-16-17-2-4-18(5-3-17)24(26)27;/h2-5,25H,1,6-16H2,(H2,20,21,22);1H |
| InChIKey | HLZWQZRJKOUQIX-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 121.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.40 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|