C21H34N6O4 — CID 111187725
1-(2-morpholin-4-ylethyl)-3-(3-morpholin-4-ylpropyl)-2-[(4-nitrophenyl)methyl]guanidine (PubChem CID 111187725) has the molecular formula C21H34N6O4 and a molecular weight of 434.54 g/mol. Its IUPAC name is 1-(2-morpholin-4-ylethyl)-3-(3-morpholin-4-ylpropyl)-2-[(4-nitrophenyl)methyl]guanidine.
| Compound Name | 1-(2-morpholin-4-ylethyl)-3-(3-morpholin-4-ylpropyl)-2-[(4-nitrophenyl)methyl]guanidine |
|---|---|
| PubChem CID | 111187725 |
| Molecular Formula | C21H34N6O4 |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.26 |
| IUPAC Name | 1-(2-morpholin-4-ylethyl)-3-(3-morpholin-4-ylpropyl)-2-[(4-nitrophenyl)methyl]guanidine |
| SMILES | O=[N+]([O-])c1ccc(C/N=C(\NCCCN2CCOCC2)NCCN2CCOCC2)cc1 |
| InChI | InChI=1S/C21H34N6O4/c28-27(29)20-4-2-19(3-5-20)18-24-21(23-7-9-26-12-16-31-17-13-26)22-6-1-8-25-10-14-30-15-11-25/h2-5H,1,6-18H2,(H2,22,23,24) |
| InChIKey | JJELKXNGJNPXEI-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 104.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|