C20H27IN4O4S — CID 111979676
1-[2-(2-hydroxyethoxy)ethyl]-2-[(4-nitrophenyl)methyl]-3-(2-phenylsulfanylethyl)guanidine;hydroiodide (PubChem CID 111979676) has the molecular formula C20H27IN4O4S and a molecular weight of 546.43 g/mol. Its IUPAC name is 1-[2-(2-hydroxyethoxy)ethyl]-2-[(4-nitrophenyl)methyl]-3-(2-phenylsulfanylethyl)guanidine;hydroiodide.
| Compound Name | 1-[2-(2-hydroxyethoxy)ethyl]-2-[(4-nitrophenyl)methyl]-3-(2-phenylsulfanylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111979676 |
| Molecular Formula | C20H27IN4O4S |
| Molecular Weight | 546.43 g/mol |
| Exact Mass | 546.08 |
| IUPAC Name | 1-[2-(2-hydroxyethoxy)ethyl]-2-[(4-nitrophenyl)methyl]-3-(2-phenylsulfanylethyl)guanidine;hydroiodide |
| SMILES | I.O=[N+]([O-])c1ccc(C/N=C(\NCCOCCO)NCCSc2ccccc2)cc1 |
| InChI | InChI=1S/C20H26N4O4S.HI/c25-12-14-28-13-10-21-20(22-11-15-29-19-4-2-1-3-5-19)23-16-17-6-8-18(9-7-17)24(26)27;/h1-9,25H,10-16H2,(H2,21,22,23);1H |
| InChIKey | ILKHOVKLQBKWED-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 109.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.43 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|