C14H22N4O4 — CID 111491810
1,3-bis(2-methoxyethyl)-2-[(4-nitrophenyl)methyl]guanidine (PubChem CID 111491810) has the molecular formula C14H22N4O4 and a molecular weight of 310.35 g/mol. Its IUPAC name is 1,3-bis(2-methoxyethyl)-2-[(4-nitrophenyl)methyl]guanidine.
| Compound Name | 1,3-bis(2-methoxyethyl)-2-[(4-nitrophenyl)methyl]guanidine |
|---|---|
| PubChem CID | 111491810 |
| Molecular Formula | C14H22N4O4 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.16 |
| IUPAC Name | 1,3-bis(2-methoxyethyl)-2-[(4-nitrophenyl)methyl]guanidine |
| SMILES | COCCNC(=NCc1ccc([N+](=O)[O-])cc1)NCCOC |
| InChI | InChI=1S/C14H22N4O4/c1-21-9-7-15-14(16-8-10-22-2)17-11-12-3-5-13(6-4-12)18(19)20/h3-6H,7-11H2,1-2H3,(H2,15,16,17) |
| InChIKey | DJCNQECZEKHIEO-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 98.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|