C21H26IN5O3 — CID 111537418
1-[2-(1H-indol-3-yl)ethyl]-3-(2-methoxyethyl)-2-[(4-nitrophenyl)methyl]guanidine;hydroiodide (PubChem CID 111537418) has the molecular formula C21H26IN5O3 and a molecular weight of 523.38 g/mol. Its IUPAC name is 1-[2-(1H-indol-3-yl)ethyl]-3-(2-methoxyethyl)-2-[(4-nitrophenyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(1H-indol-3-yl)ethyl]-3-(2-methoxyethyl)-2-[(4-nitrophenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111537418 |
| Molecular Formula | C21H26IN5O3 |
| Molecular Weight | 523.38 g/mol |
| Exact Mass | 523.11 |
| IUPAC Name | 1-[2-(1H-indol-3-yl)ethyl]-3-(2-methoxyethyl)-2-[(4-nitrophenyl)methyl]guanidine;hydroiodide |
| SMILES | COCCN/C(=N\Cc1ccc([N+](=O)[O-])cc1)NCCc1c[nH]c2ccccc12.I |
| InChI | InChI=1S/C21H25N5O3.HI/c1-29-13-12-23-21(25-14-16-6-8-18(9-7-16)26(27)28)22-11-10-17-15-24-20-5-3-2-4-19(17)20;/h2-9,15,24H,10-14H2,1H3,(H2,22,23,25);1H |
| InChIKey | YDGJCCXEBAAKLC-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 104.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.38 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|