C21H29IN4O6 — CID 111751730
1-(2-methoxyethyl)-3-[(4-nitrophenyl)methyl]-2-[(3,4,5-trimethoxyphenyl)methyl]guanidine;hydroiodide (PubChem CID 111751730) has the molecular formula C21H29IN4O6 and a molecular weight of 560.39 g/mol. Its IUPAC name is 1-(2-methoxyethyl)-3-[(4-nitrophenyl)methyl]-2-[(3,4,5-trimethoxyphenyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-(2-methoxyethyl)-3-[(4-nitrophenyl)methyl]-2-[(3,4,5-trimethoxyphenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111751730 |
| Molecular Formula | C21H29IN4O6 |
| Molecular Weight | 560.39 g/mol |
| Exact Mass | 560.11 |
| IUPAC Name | 1-(2-methoxyethyl)-3-[(4-nitrophenyl)methyl]-2-[(3,4,5-trimethoxyphenyl)methyl]guanidine;hydroiodide |
| SMILES | COCCN/C(=N\Cc1cc(OC)c(OC)c(OC)c1)NCc1ccc([N+](=O)[O-])cc1.I |
| InChI | InChI=1S/C21H28N4O6.HI/c1-28-10-9-22-21(23-13-15-5-7-17(8-6-15)25(26)27)24-14-16-11-18(29-2)20(31-4)19(12-16)30-3;/h5-8,11-12H,9-10,13-14H2,1-4H3,(H2,22,23,24);1H |
| InChIKey | ZKJOVTPNBKFAMX-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 116.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.39 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|