C22H31IN4O5 — CID 111777888
1-(2-methylpropyl)-3-[(4-nitrophenyl)methyl]-2-[(3,4,5-trimethoxyphenyl)methyl]guanidine;hydroiodide (PubChem CID 111777888) has the molecular formula C22H31IN4O5 and a molecular weight of 558.42 g/mol. Its IUPAC name is 1-(2-methylpropyl)-3-[(4-nitrophenyl)methyl]-2-[(3,4,5-trimethoxyphenyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-(2-methylpropyl)-3-[(4-nitrophenyl)methyl]-2-[(3,4,5-trimethoxyphenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111777888 |
| Molecular Formula | C22H31IN4O5 |
| Molecular Weight | 558.42 g/mol |
| Exact Mass | 558.13 |
| IUPAC Name | 1-(2-methylpropyl)-3-[(4-nitrophenyl)methyl]-2-[(3,4,5-trimethoxyphenyl)methyl]guanidine;hydroiodide |
| SMILES | COc1cc(C/N=C(/NCc2ccc([N+](=O)[O-])cc2)NCC(C)C)cc(OC)c1OC.I |
| InChI | InChI=1S/C22H30N4O5.HI/c1-15(2)12-23-22(24-13-16-6-8-18(9-7-16)26(27)28)25-14-17-10-19(29-3)21(31-5)20(11-17)30-4;/h6-11,15H,12-14H2,1-5H3,(H2,23,24,25);1H |
| InChIKey | CVAWQICJZJRUIA-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 107.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.42 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|