C22H28IN5O3S — CID 111493597
4-acetyl-N'-[(4-nitrophenyl)methyl]-N-(2-phenylsulfanylethyl)piperazine-1-carboximidamide;hydroiodide (PubChem CID 111493597) has the molecular formula C22H28IN5O3S and a molecular weight of 569.47 g/mol. Its IUPAC name is 4-acetyl-N'-[(4-nitrophenyl)methyl]-N-(2-phenylsulfanylethyl)piperazine-1-carboximidamide;hydroiodide.
| Compound Name | 4-acetyl-N'-[(4-nitrophenyl)methyl]-N-(2-phenylsulfanylethyl)piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111493597 |
| Molecular Formula | C22H28IN5O3S |
| Molecular Weight | 569.47 g/mol |
| Exact Mass | 569.10 |
| IUPAC Name | 4-acetyl-N'-[(4-nitrophenyl)methyl]-N-(2-phenylsulfanylethyl)piperazine-1-carboximidamide;hydroiodide |
| SMILES | CC(=O)N1CCN(/C(=N/Cc2ccc([N+](=O)[O-])cc2)NCCSc2ccccc2)CC1.I |
| InChI | InChI=1S/C22H27N5O3S.HI/c1-18(28)25-12-14-26(15-13-25)22(23-11-16-31-21-5-3-2-4-6-21)24-17-19-7-9-20(10-8-19)27(29)30;/h2-10H,11-17H2,1H3,(H,23,24);1H |
| InChIKey | SJUPYBTUQFVKOA-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 91.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.47 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|