C17H27IN4O3 — CID 110956059
N-(3-ethoxypropyl)-N'-[(4-nitrophenyl)methyl]pyrrolidine-1-carboximidamide;hydroiodide (PubChem CID 110956059) has the molecular formula C17H27IN4O3 and a molecular weight of 462.33 g/mol. Its IUPAC name is N-(3-ethoxypropyl)-N'-[(4-nitrophenyl)methyl]pyrrolidine-1-carboximidamide;hydroiodide.
| Compound Name | N-(3-ethoxypropyl)-N'-[(4-nitrophenyl)methyl]pyrrolidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 110956059 |
| Molecular Formula | C17H27IN4O3 |
| Molecular Weight | 462.33 g/mol |
| Exact Mass | 462.11 |
| IUPAC Name | N-(3-ethoxypropyl)-N'-[(4-nitrophenyl)methyl]pyrrolidine-1-carboximidamide;hydroiodide |
| SMILES | CCOCCCN/C(=N\Cc1ccc([N+](=O)[O-])cc1)N1CCCC1.I |
| InChI | InChI=1S/C17H26N4O3.HI/c1-2-24-13-5-10-18-17(20-11-3-4-12-20)19-14-15-6-8-16(9-7-15)21(22)23;/h6-9H,2-5,10-14H2,1H3,(H,18,19);1H |
| InChIKey | QVJHWTBFVLMSRI-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 80.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.33 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|