C17H29IN4O3 — CID 110944865
1-butan-2-yl-3-(3-ethoxypropyl)-2-[(4-nitrophenyl)methyl]guanidine;hydroiodide (PubChem CID 110944865) has the molecular formula C17H29IN4O3 and a molecular weight of 464.35 g/mol. Its IUPAC name is 1-butan-2-yl-3-(3-ethoxypropyl)-2-[(4-nitrophenyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-butan-2-yl-3-(3-ethoxypropyl)-2-[(4-nitrophenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 110944865 |
| Molecular Formula | C17H29IN4O3 |
| Molecular Weight | 464.35 g/mol |
| Exact Mass | 464.13 |
| IUPAC Name | 1-butan-2-yl-3-(3-ethoxypropyl)-2-[(4-nitrophenyl)methyl]guanidine;hydroiodide |
| SMILES | CCOCCCN/C(=N\Cc1ccc([N+](=O)[O-])cc1)NC(C)CC.I |
| InChI | InChI=1S/C17H28N4O3.HI/c1-4-14(3)20-17(18-11-6-12-24-5-2)19-13-15-7-9-16(10-8-15)21(22)23;/h7-10,14H,4-6,11-13H2,1-3H3,(H2,18,19,20);1H |
| InChIKey | XHUOFPMIMGEUKU-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 88.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.35 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|