C21H37N5O3 — CID 111761227
1-[5-(diethylamino)pentan-2-yl]-3-(3-methoxypropyl)-2-[(4-nitrophenyl)methyl]guanidine (PubChem CID 111761227) has the molecular formula C21H37N5O3 and a molecular weight of 407.56 g/mol. Its IUPAC name is 1-[5-(diethylamino)pentan-2-yl]-3-(3-methoxypropyl)-2-[(4-nitrophenyl)methyl]guanidine.
| Compound Name | 1-[5-(diethylamino)pentan-2-yl]-3-(3-methoxypropyl)-2-[(4-nitrophenyl)methyl]guanidine |
|---|---|
| PubChem CID | 111761227 |
| Molecular Formula | C21H37N5O3 |
| Molecular Weight | 407.56 g/mol |
| Exact Mass | 407.29 |
| IUPAC Name | 1-[5-(diethylamino)pentan-2-yl]-3-(3-methoxypropyl)-2-[(4-nitrophenyl)methyl]guanidine |
| SMILES | CCN(CC)CCCC(C)N/C(=N/Cc1ccc([N+](=O)[O-])cc1)NCCCOC |
| InChI | InChI=1S/C21H37N5O3/c1-5-25(6-2)15-7-9-18(3)24-21(22-14-8-16-29-4)23-17-19-10-12-20(13-11-19)26(27)28/h10-13,18H,5-9,14-17H2,1-4H3,(H2,22,23,24) |
| InChIKey | SLMCSNRXXVLNJD-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 92.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.56 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|