C21H37IN6O3 — CID 111885716
2-[[N-[5-(diethylamino)pentan-2-yl]-N'-[(4-nitrophenyl)methyl]carbamimidoyl]amino]-N,N-dimethylacetamide;hydroiodide (PubChem CID 111885716) has the molecular formula C21H37IN6O3 and a molecular weight of 548.47 g/mol. Its IUPAC name is 2-[[N-[5-(diethylamino)pentan-2-yl]-N'-[(4-nitrophenyl)methyl]carbamimidoyl]amino]-N,N-dimethylacetamide;hydroiodide.
| Compound Name | 2-[[N-[5-(diethylamino)pentan-2-yl]-N'-[(4-nitrophenyl)methyl]carbamimidoyl]amino]-N,N-dimethylacetamide;hydroiodide |
|---|---|
| PubChem CID | 111885716 |
| Molecular Formula | C21H37IN6O3 |
| Molecular Weight | 548.47 g/mol |
| Exact Mass | 548.20 |
| IUPAC Name | 2-[[N-[5-(diethylamino)pentan-2-yl]-N'-[(4-nitrophenyl)methyl]carbamimidoyl]amino]-N,N-dimethylacetamide;hydroiodide |
| SMILES | CCN(CC)CCCC(C)N/C(=N/Cc1ccc([N+](=O)[O-])cc1)NCC(=O)N(C)C.I |
| InChI | InChI=1S/C21H36N6O3.HI/c1-6-26(7-2)14-8-9-17(3)24-21(23-16-20(28)25(4)5)22-15-18-10-12-19(13-11-18)27(29)30;/h10-13,17H,6-9,14-16H2,1-5H3,(H2,22,23,24);1H |
| InChIKey | QVUSJNKHJKVMMG-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 103.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.47 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|