C19H31N5O4 — CID 111764887
1-(3-methoxypropyl)-3-(2-morpholin-4-ylpropyl)-2-[(4-nitrophenyl)methyl]guanidine (PubChem CID 111764887) has the molecular formula C19H31N5O4 and a molecular weight of 393.49 g/mol. Its IUPAC name is 1-(3-methoxypropyl)-3-(2-morpholin-4-ylpropyl)-2-[(4-nitrophenyl)methyl]guanidine.
| Compound Name | 1-(3-methoxypropyl)-3-(2-morpholin-4-ylpropyl)-2-[(4-nitrophenyl)methyl]guanidine |
|---|---|
| PubChem CID | 111764887 |
| Molecular Formula | C19H31N5O4 |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.24 |
| IUPAC Name | 1-(3-methoxypropyl)-3-(2-morpholin-4-ylpropyl)-2-[(4-nitrophenyl)methyl]guanidine |
| SMILES | COCCCN/C(=N\Cc1ccc([N+](=O)[O-])cc1)NCC(C)N1CCOCC1 |
| InChI | InChI=1S/C19H31N5O4/c1-16(23-9-12-28-13-10-23)14-21-19(20-8-3-11-27-2)22-15-17-4-6-18(7-5-17)24(25)26/h4-7,16H,3,8-15H2,1-2H3,(H2,20,21,22) |
| InChIKey | PGARUMJYGZFBJF-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 101.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|