C17H33N7O2 — CID 111764841
2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-(3-methoxypropyl)-3-(2-morpholin-4-ylpropyl)guanidine (PubChem CID 111764841) has the molecular formula C17H33N7O2 and a molecular weight of 367.50 g/mol. Its IUPAC name is 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-(3-methoxypropyl)-3-(2-morpholin-4-ylpropyl)guanidine.
| Compound Name | 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-(3-methoxypropyl)-3-(2-morpholin-4-ylpropyl)guanidine |
|---|---|
| PubChem CID | 111764841 |
| Molecular Formula | C17H33N7O2 |
| Molecular Weight | 367.50 g/mol |
| Exact Mass | 367.27 |
| IUPAC Name | 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-(3-methoxypropyl)-3-(2-morpholin-4-ylpropyl)guanidine |
| SMILES | COCCCN/C(=N\Cc1nnc(C)n1C)NCC(C)N1CCOCC1 |
| InChI | InChI=1S/C17H33N7O2/c1-14(24-7-10-26-11-8-24)12-19-17(18-6-5-9-25-4)20-13-16-22-21-15(2)23(16)3/h14H,5-13H2,1-4H3,(H2,18,19,20) |
| InChIKey | AEXNSZTVJMHCMX-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 88.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.50 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|