C23H37N7O2 — CID 111770392
2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-[2-(4-methoxyphenyl)-2-pyrrolidin-1-ylethyl]-3-(3-methoxypropyl)guanidine (PubChem CID 111770392) has the molecular formula C23H37N7O2 and a molecular weight of 443.60 g/mol. Its IUPAC name is 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-[2-(4-methoxyphenyl)-2-pyrrolidin-1-ylethyl]-3-(3-methoxypropyl)guanidine.
| Compound Name | 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-[2-(4-methoxyphenyl)-2-pyrrolidin-1-ylethyl]-3-(3-methoxypropyl)guanidine |
|---|---|
| PubChem CID | 111770392 |
| Molecular Formula | C23H37N7O2 |
| Molecular Weight | 443.60 g/mol |
| Exact Mass | 443.30 |
| IUPAC Name | 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-[2-(4-methoxyphenyl)-2-pyrrolidin-1-ylethyl]-3-(3-methoxypropyl)guanidine |
| SMILES | COCCCN/C(=N\Cc1nnc(C)n1C)NCC(c1ccc(OC)cc1)N1CCCC1 |
| InChI | InChI=1S/C23H37N7O2/c1-18-27-28-22(29(18)2)17-26-23(24-12-7-15-31-3)25-16-21(30-13-5-6-14-30)19-8-10-20(32-4)11-9-19/h8-11,21H,5-7,12-17H2,1-4H3,(H2,24,25,26) |
| InChIKey | SRQCCKUUGHPORP-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 88.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.60 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|