C16H30IN7O — CID 111021318
2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-(2-morpholin-4-ylpropyl)-3-prop-2-enylguanidine;hydroiodide (PubChem CID 111021318) has the molecular formula C16H30IN7O and a molecular weight of 463.37 g/mol. Its IUPAC name is 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-(2-morpholin-4-ylpropyl)-3-prop-2-enylguanidine;hydroiodide.
| Compound Name | 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-(2-morpholin-4-ylpropyl)-3-prop-2-enylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111021318 |
| Molecular Formula | C16H30IN7O |
| Molecular Weight | 463.37 g/mol |
| Exact Mass | 463.16 |
| IUPAC Name | 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-(2-morpholin-4-ylpropyl)-3-prop-2-enylguanidine;hydroiodide |
| SMILES | C=CCN/C(=N\Cc1nnc(C)n1C)NCC(C)N1CCOCC1.I |
| InChI | InChI=1S/C16H29N7O.HI/c1-5-6-17-16(19-12-15-21-20-14(3)22(15)4)18-11-13(2)23-7-9-24-10-8-23;/h5,13H,1,6-12H2,2-4H3,(H2,17,18,19);1H |
| InChIKey | OOMHSFDOAURZNP-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 79.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.37 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|