C22H31IN4O6 — CID 111146163
1-(3-ethoxypropyl)-2-[(4-nitrophenyl)methyl]-3-(3,4,5-trimethoxyphenyl)guanidine;hydroiodide (PubChem CID 111146163) has the molecular formula C22H31IN4O6 and a molecular weight of 574.42 g/mol. Its IUPAC name is 1-(3-ethoxypropyl)-2-[(4-nitrophenyl)methyl]-3-(3,4,5-trimethoxyphenyl)guanidine;hydroiodide.
| Compound Name | 1-(3-ethoxypropyl)-2-[(4-nitrophenyl)methyl]-3-(3,4,5-trimethoxyphenyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111146163 |
| Molecular Formula | C22H31IN4O6 |
| Molecular Weight | 574.42 g/mol |
| Exact Mass | 574.13 |
| IUPAC Name | 1-(3-ethoxypropyl)-2-[(4-nitrophenyl)methyl]-3-(3,4,5-trimethoxyphenyl)guanidine;hydroiodide |
| SMILES | CCOCCCN/C(=N\Cc1ccc([N+](=O)[O-])cc1)Nc1cc(OC)c(OC)c(OC)c1.I |
| InChI | InChI=1S/C22H30N4O6.HI/c1-5-32-12-6-11-23-22(24-15-16-7-9-18(10-8-16)26(27)28)25-17-13-19(29-2)21(31-4)20(14-17)30-3;/h7-10,13-14H,5-6,11-12,15H2,1-4H3,(H2,23,24,25);1H |
| InChIKey | XIDHUPQDSGHCRV-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 116.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.42 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|