C18H28N4O4 — CID 111136707
1-(3-ethoxypropyl)-2-[(4-nitrophenyl)methyl]-3-(oxolan-2-ylmethyl)guanidine (PubChem CID 111136707) has the molecular formula C18H28N4O4 and a molecular weight of 364.45 g/mol. Its IUPAC name is 1-(3-ethoxypropyl)-2-[(4-nitrophenyl)methyl]-3-(oxolan-2-ylmethyl)guanidine.
| Compound Name | 1-(3-ethoxypropyl)-2-[(4-nitrophenyl)methyl]-3-(oxolan-2-ylmethyl)guanidine |
|---|---|
| PubChem CID | 111136707 |
| Molecular Formula | C18H28N4O4 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.21 |
| IUPAC Name | 1-(3-ethoxypropyl)-2-[(4-nitrophenyl)methyl]-3-(oxolan-2-ylmethyl)guanidine |
| SMILES | CCOCCCN/C(=N\Cc1ccc([N+](=O)[O-])cc1)NCC1CCCO1 |
| InChI | InChI=1S/C18H28N4O4/c1-2-25-11-4-10-19-18(21-14-17-5-3-12-26-17)20-13-15-6-8-16(9-7-15)22(23)24/h6-9,17H,2-5,10-14H2,1H3,(H2,19,20,21) |
| InChIKey | GEWBDPFSAMUVHV-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 98.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|