C21H27IN4O4 — CID 111541219
1-[(2-methoxyphenyl)methyl]-2-[(4-nitrophenyl)methyl]-3-(oxolan-2-ylmethyl)guanidine;hydroiodide (PubChem CID 111541219) has the molecular formula C21H27IN4O4 and a molecular weight of 526.38 g/mol. Its IUPAC name is 1-[(2-methoxyphenyl)methyl]-2-[(4-nitrophenyl)methyl]-3-(oxolan-2-ylmethyl)guanidine;hydroiodide.
| Compound Name | 1-[(2-methoxyphenyl)methyl]-2-[(4-nitrophenyl)methyl]-3-(oxolan-2-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111541219 |
| Molecular Formula | C21H27IN4O4 |
| Molecular Weight | 526.38 g/mol |
| Exact Mass | 526.11 |
| IUPAC Name | 1-[(2-methoxyphenyl)methyl]-2-[(4-nitrophenyl)methyl]-3-(oxolan-2-ylmethyl)guanidine;hydroiodide |
| SMILES | COc1ccccc1CN/C(=N/Cc1ccc([N+](=O)[O-])cc1)NCC1CCCO1.I |
| InChI | InChI=1S/C21H26N4O4.HI/c1-28-20-7-3-2-5-17(20)14-23-21(24-15-19-6-4-12-29-19)22-13-16-8-10-18(11-9-16)25(26)27;/h2-3,5,7-11,19H,4,6,12-15H2,1H3,(H2,22,23,24);1H |
| InChIKey | FGDUNSHYUVSFTP-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 98.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.38 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|