C22H30IN5O4 — CID 111769704
1-[(2-methoxyphenyl)methyl]-3-(2-morpholin-4-ylethyl)-2-[(4-nitrophenyl)methyl]guanidine;hydroiodide (PubChem CID 111769704) has the molecular formula C22H30IN5O4 and a molecular weight of 555.42 g/mol. Its IUPAC name is 1-[(2-methoxyphenyl)methyl]-3-(2-morpholin-4-ylethyl)-2-[(4-nitrophenyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[(2-methoxyphenyl)methyl]-3-(2-morpholin-4-ylethyl)-2-[(4-nitrophenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111769704 |
| Molecular Formula | C22H30IN5O4 |
| Molecular Weight | 555.42 g/mol |
| Exact Mass | 555.13 |
| IUPAC Name | 1-[(2-methoxyphenyl)methyl]-3-(2-morpholin-4-ylethyl)-2-[(4-nitrophenyl)methyl]guanidine;hydroiodide |
| SMILES | COc1ccccc1CN/C(=N/Cc1ccc([N+](=O)[O-])cc1)NCCN1CCOCC1.I |
| InChI | InChI=1S/C22H29N5O4.HI/c1-30-21-5-3-2-4-19(21)17-25-22(23-10-11-26-12-14-31-15-13-26)24-16-18-6-8-20(9-7-18)27(28)29;/h2-9H,10-17H2,1H3,(H2,23,24,25);1H |
| InChIKey | BNXLSZWIAJFHBD-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 101.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.42 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|