C17H25IN4O3 — CID 110020583
2-[(4-nitrophenyl)methyl]-1-(oxan-2-ylmethyl)-3-prop-2-enylguanidine;hydroiodide (PubChem CID 110020583) has the molecular formula C17H25IN4O3 and a molecular weight of 460.32 g/mol. Its IUPAC name is 2-[(4-nitrophenyl)methyl]-1-(oxan-2-ylmethyl)-3-prop-2-enylguanidine;hydroiodide.
| Compound Name | 2-[(4-nitrophenyl)methyl]-1-(oxan-2-ylmethyl)-3-prop-2-enylguanidine;hydroiodide |
|---|---|
| PubChem CID | 110020583 |
| Molecular Formula | C17H25IN4O3 |
| Molecular Weight | 460.32 g/mol |
| Exact Mass | 460.10 |
| IUPAC Name | 2-[(4-nitrophenyl)methyl]-1-(oxan-2-ylmethyl)-3-prop-2-enylguanidine;hydroiodide |
| SMILES | C=CCN/C(=N\Cc1ccc([N+](=O)[O-])cc1)NCC1CCCCO1.I |
| InChI | InChI=1S/C17H24N4O3.HI/c1-2-10-18-17(20-13-16-5-3-4-11-24-16)19-12-14-6-8-15(9-7-14)21(22)23;/h2,6-9,16H,1,3-5,10-13H2,(H2,18,19,20);1H |
| InChIKey | JZIFLISVTIJEHP-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 88.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.32 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|