C17H24N4O2 — CID 110958281
1-cyclohexyl-2-[(4-nitrophenyl)methyl]-3-prop-2-enylguanidine (PubChem CID 110958281) has the molecular formula C17H24N4O2 and a molecular weight of 316.41 g/mol. Its IUPAC name is 1-cyclohexyl-2-[(4-nitrophenyl)methyl]-3-prop-2-enylguanidine.
| Compound Name | 1-cyclohexyl-2-[(4-nitrophenyl)methyl]-3-prop-2-enylguanidine |
|---|---|
| PubChem CID | 110958281 |
| Molecular Formula | C17H24N4O2 |
| Molecular Weight | 316.41 g/mol |
| Exact Mass | 316.19 |
| IUPAC Name | 1-cyclohexyl-2-[(4-nitrophenyl)methyl]-3-prop-2-enylguanidine |
| SMILES | C=CCN/C(=N\Cc1ccc([N+](=O)[O-])cc1)NC1CCCCC1 |
| InChI | InChI=1S/C17H24N4O2/c1-2-12-18-17(20-15-6-4-3-5-7-15)19-13-14-8-10-16(11-9-14)21(22)23/h2,8-11,15H,1,3-7,12-13H2,(H2,18,19,20) |
| InChIKey | XXPSYZXLOLPRFS-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 79.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.41 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|