C20H25N5O4S — CID 136920582
1-cyclopentyl-3-[(4-nitrophenyl)methyl]-2-[(4-sulfamoylphenyl)methyl]guanidine (PubChem CID 136920582) has the molecular formula C20H25N5O4S and a molecular weight of 431.52 g/mol. Its IUPAC name is 1-cyclopentyl-3-[(4-nitrophenyl)methyl]-2-[(4-sulfamoylphenyl)methyl]guanidine.
| Compound Name | 1-cyclopentyl-3-[(4-nitrophenyl)methyl]-2-[(4-sulfamoylphenyl)methyl]guanidine |
|---|---|
| PubChem CID | 136920582 |
| Molecular Formula | C20H25N5O4S |
| Molecular Weight | 431.52 g/mol |
| Exact Mass | 431.16 |
| IUPAC Name | 1-cyclopentyl-3-[(4-nitrophenyl)methyl]-2-[(4-sulfamoylphenyl)methyl]guanidine |
| SMILES | NS(=O)(=O)c1ccc(C/N=C(\NCc2ccc([N+](=O)[O-])cc2)NC2CCCC2)cc1 |
| InChI | InChI=1S/C20H25N5O4S/c21-30(28,29)19-11-7-16(8-12-19)14-23-20(24-17-3-1-2-4-17)22-13-15-5-9-18(10-6-15)25(26)27/h5-12,17H,1-4,13-14H2,(H2,21,28,29)(H2,22,23,24) |
| InChIKey | VSMQQLCKOQEIOG-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 139.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.52 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|