C18H24IN5O4S2 — CID 136922926
1-(2-methylsulfanylethyl)-3-[(4-nitrophenyl)methyl]-2-[(4-sulfamoylphenyl)methyl]guanidine;hydroiodide (PubChem CID 136922926) has the molecular formula C18H24IN5O4S2 and a molecular weight of 565.46 g/mol. Its IUPAC name is 1-(2-methylsulfanylethyl)-3-[(4-nitrophenyl)methyl]-2-[(4-sulfamoylphenyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-(2-methylsulfanylethyl)-3-[(4-nitrophenyl)methyl]-2-[(4-sulfamoylphenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 136922926 |
| Molecular Formula | C18H24IN5O4S2 |
| Molecular Weight | 565.46 g/mol |
| Exact Mass | 565.03 |
| IUPAC Name | 1-(2-methylsulfanylethyl)-3-[(4-nitrophenyl)methyl]-2-[(4-sulfamoylphenyl)methyl]guanidine;hydroiodide |
| SMILES | CSCCN/C(=N\Cc1ccc(S(N)(=O)=O)cc1)NCc1ccc([N+](=O)[O-])cc1.I |
| InChI | InChI=1S/C18H23N5O4S2.HI/c1-28-11-10-20-18(21-12-14-2-6-16(7-3-14)23(24)25)22-13-15-4-8-17(9-5-15)29(19,26)27;/h2-9H,10-13H2,1H3,(H2,19,26,27)(H2,20,21,22);1H |
| InChIKey | MOVLDPKOFJVPNQ-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 139.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.46 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|