C12H21IN4O2S2 — CID 111344324
2-methyl-1-(2-methylsulfanylethyl)-3-[(4-sulfamoylphenyl)methyl]guanidine;hydroiodide (PubChem CID 111344324) has the molecular formula C12H21IN4O2S2 and a molecular weight of 444.36 g/mol. Its IUPAC name is 2-methyl-1-(2-methylsulfanylethyl)-3-[(4-sulfamoylphenyl)methyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-(2-methylsulfanylethyl)-3-[(4-sulfamoylphenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111344324 |
| Molecular Formula | C12H21IN4O2S2 |
| Molecular Weight | 444.36 g/mol |
| Exact Mass | 444.02 |
| IUPAC Name | 2-methyl-1-(2-methylsulfanylethyl)-3-[(4-sulfamoylphenyl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCCSC)NCc1ccc(S(N)(=O)=O)cc1.I |
| InChI | InChI=1S/C12H20N4O2S2.HI/c1-14-12(15-7-8-19-2)16-9-10-3-5-11(6-4-10)20(13,17)18;/h3-6H,7-9H2,1-2H3,(H2,13,17,18)(H2,14,15,16);1H |
| InChIKey | STDGCPUEEQIGKV-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 96.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.36 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|