C18H25IN4O4S — CID 111200889
1-[(3,4-dimethoxyphenyl)methyl]-2-methyl-3-[(4-sulfamoylphenyl)methyl]guanidine;hydroiodide (PubChem CID 111200889) has the molecular formula C18H25IN4O4S and a molecular weight of 520.39 g/mol. Its IUPAC name is 1-[(3,4-dimethoxyphenyl)methyl]-2-methyl-3-[(4-sulfamoylphenyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[(3,4-dimethoxyphenyl)methyl]-2-methyl-3-[(4-sulfamoylphenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111200889 |
| Molecular Formula | C18H25IN4O4S |
| Molecular Weight | 520.39 g/mol |
| Exact Mass | 520.06 |
| IUPAC Name | 1-[(3,4-dimethoxyphenyl)methyl]-2-methyl-3-[(4-sulfamoylphenyl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCc1ccc(S(N)(=O)=O)cc1)NCc1ccc(OC)c(OC)c1.I |
| InChI | InChI=1S/C18H24N4O4S.HI/c1-20-18(21-11-13-4-7-15(8-5-13)27(19,23)24)22-12-14-6-9-16(25-2)17(10-14)26-3;/h4-10H,11-12H2,1-3H3,(H2,19,23,24)(H2,20,21,22);1H |
| InChIKey | VWTNTBHWKDFFEJ-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 115.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.39 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|